For research use only. Not for therapeutic Use.
Penicillin G Sodium(Cat No.:A000589)is a natural penicillin antibiotic used to treat various bacterial infections, including syphilis, streptococcal infections, and bacterial endocarditis. It works by inhibiting cell wall synthesis in susceptible bacteria, leading to cell lysis and death. Administered intravenously or intramuscularly, Penicillin G Sodium is highly effective against gram-positive bacteria and some gram-negative organisms. It is well-tolerated, with allergic reactions being the most common side effect. Penicillin G Sodium remains a cornerstone in antimicrobial therapy, crucial for treating severe infections and preventing complications in various bacterial diseases.
Catalog Number | A000589 |
CAS Number | 69-57-8 |
Synonyms | Benzylpenicillin Sodium |
Molecular Formula | C16H17N2NaO4S |
Purity | ≥95% |
Target | Beta-lactamase |
Storage | 3 years -20C powder |
IUPAC Name | sodium;(2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
InChI | InChI=1S/C16H18N2O4S.Na/c1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9;/h3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);/q;+1/p-1/t11-,12+,14-;/m1./s1 |
InChIKey | FCPVYOBCFFNJFS-LQDWTQKMSA-M |
SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)[O-])C.[Na+] |