For research use only. Not for therapeutic Use.
Pentabromobenzyl Acrylate (Cat No.:C001039) is a synthetic organic compound used as a flame retardant and as a reactive additive in polymerization processes. It is a colorless to light yellow liquid with a characteristic acrid odor. The compound’s brominated structure provides flame-retardant properties, making it suitable for applications in plastics, textiles, and electronic materials to enhance fire resistance. However, it may pose environmental and health concerns due to its persistence and potential toxicity.
| Catalog Number | C001039 |
| CAS Number | 59447-55-1 |
| Synonyms | 2,3,4,5,6-Pentabromobenzyl Acrylate; Actimer FR 1025M; FR 1025M; (Pentabromophenyl)methyl Ester 2-Propenoic Acid |
| Molecular Formula | C10H5Br5O2 |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| Appearance | White to Off-White Solid |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | (2,3,4,5,6-pentabromophenyl)methyl prop-2-enoate |
| InChI | InChI=1S/C10H5Br5O2/c1-2-5(16)17-3-4-6(11)8(13)10(15)9(14)7(4)12/h2H,1,3H2 |
| InChIKey | GRKDVZMVHOLESV-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC1=C(C(=C(C(=C1Br)Br)Br)Br)Br |
| Reference | EPA. Method 1668, (EPA 821-R-00-002) (1999); Melymuk, L., et al.: Anal. Bioanal. Chem 407, 6759 (2015) |
