For research use only. Not for therapeutic Use.
Pentabromoethylbenzene (Cat No.:C001038) is a synthetic organic compound. It is a white crystalline solid that belongs to the family of brominated aromatic compounds. The compound is primarily used as a flame retardant and as a reactive additive in polymerization processes. Its brominated structure enhances fire resistance, making it suitable for applications in plastics, textiles, and electronic materials. However, it may pose environmental and health concerns due to its persistence and potential toxicity.
| Catalog Number | C001038 |
| CAS Number | 85-22-3 |
| Synonyms | Pentabromoethyl-benzene; 1,2,3,4,5-Pentabromo-6-ethylbenzene; 2,3,4,5,6-Pentabromoethylbenzene; EB 80 |
| Molecular Formula | C₈H₅Br₅ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly, heated) |
| Appearance | White to Off-White Solid |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-ethylbenzene |
| InChI | InChI=1S/C8H5Br5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H2,1H3 |
| InChIKey | FIAXCDIQXHJNIX-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C(=C1Br)Br)Br)Br)Br |
| Reference | EPA. Method 1668, (EPA 821-R-00-002) (1999); Xu, P., et al.: Environ. Pollut 228, 61 (2017) |
