For research use only. Not for therapeutic Use.
Pentaerythritol Triallyl Ether(Cat No.:M050555), is a chemical compound used in the synthesis of various polymeric materials. It is a triallyl ether derivative of pentaerythritol, containing three allyl functional groups. This compound is valued in the polymer industry as a crosslinking agent. It plays a crucial role in the production of crosslinked polymers like polyethylene, which have enhanced mechanical properties and thermal stability. Pentaerythritol Triallyl Ether is employed in the manufacture of resins, coatings, adhesives, and elastomers, where its ability to form strong covalent bonds between polymer chains contributes to improved material performance and durability.
Catalog Number | M050555 |
CAS Number | 1471-17-6 |
Molecular Formula | C14H24O4 |
Purity | ≥95% |
Documentation | |
Storage | 2-8°C |
IUPAC Name | 3-prop-2-enoxy-2,2-bis(prop-2-enoxymethyl)propan-1-ol |
InChI | InChI=1S/C14H24O4/c1-4-7-16-11-14(10-15,12-17-8-5-2)13-18-9-6-3/h4-6,15H,1-3,7-13H2 |
InChIKey | FYRWKWGEFZTOQI-UHFFFAOYSA-N |
SMILES | C=CCOCC(CO)(COCC=C)COCC=C |