For research use only. Not for therapeutic Use.
Pentagamavunon-1 (Cat No.:I015190) is an orally active analog of Curcumin, a natural compound found in turmeric. PGV-1 triggers apoptotic signaling through various mechanisms, including the inhibition of cyclooxygenase-2 (COX-2) and vascular endothelial growth factor (VEGF). Additionally, PGV-1 inhibits the activation of nuclear factor-kappa B (NF-κB), a transcription factor involved in inflammatory and immune responses.
Catalog Number | I015190 |
CAS Number | 27060-70-4 |
Molecular Formula | C₂₃H₂₄O₃ |
Purity | ≥95% |
Target | Immunology/Inflammation |
Storage | Store at -20°C |
IUPAC Name | (2E,5E)-2,5-bis[(4-hydroxy-3,5-dimethylphenyl)methylidene]cyclopentan-1-one |
InChI | InChI=1S/C23H24O3/c1-13-7-17(8-14(2)21(13)24)11-19-5-6-20(23(19)26)12-18-9-15(3)22(25)16(4)10-18/h7-12,24-25H,5-6H2,1-4H3/b19-11+,20-12+ |
InChIKey | OHSKJRMWVIVJCP-AYKLPDECSA-N |
SMILES | CC1=CC(=CC(=C1O)C)C=C2CCC(=CC3=CC(=C(C(=C3)C)O)C)C2=O |