For research use only. Not for therapeutic Use.
Pentamethoxybenzene（Cat No.:M062381） is an organic compound characterized by the presence of five methoxy groups attached to a benzene ring. Its chemical formula is C11H16O5. This compound is notable for its use in organic synthesis, particularly in the preparation of more complex chemical structures. The multiple methoxy groups make pentamethoxybenzene a highly reactive and useful intermediate for various synthetic transformations. In research, pentamethoxybenzene serves as a building block in the synthesis of natural products and other specialized organic compounds. Its properties and applications are significant in fields like pharmaceuticals and materials science.
| Catalog Number | M062381 |
| CAS Number | 13909-75-6 |
| Molecular Formula | C11H16O5 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | 1,2,3,4,5-pentamethoxybenzene |
| InChI | InChI=1S/C11H16O5/c1-12-7-6-8(13-2)10(15-4)11(16-5)9(7)14-3/h6H,1-5H3 |
| InChIKey | KRFCEAVXBLUVGC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1OC)OC)OC)OC |
