For research use only. Not for therapeutic Use.
Pentan-3-amine-d5 (Cat No.:R046313) is a deuterated analog of pentan-3-amine, where the hydrogen atoms are replaced with deuterium, providing a stable isotope label for research and analytical purposes. This compound is primarily used in studies involving metabolic pathways, isotope labeling, or drug development where isotopic substitution is required for tracing and quantification. The deuterium-labeled version aids in enhancing signal clarity in NMR spectroscopy or mass spectrometry. Pentan-3-amine-d5 can also be employed in the synthesis of labeled biomolecules or pharmaceutical intermediates.
CAS Number | 1219802-43-3 |
Synonyms | 2,2,3,4,4-pentadeuteriopentan-3-amine |
Molecular Formula | C5H8D5N |
Purity | ≥95% |
IUPAC Name | 2,2,3,4,4-pentadeuteriopentan-3-amine |
InChI | InChI=1S/C5H13N/c1-3-5(6)4-2/h5H,3-4,6H2,1-2H3/i3D2,4D2,5D |
InChIKey | PQPFFKCJENSZKL-ZDGANNJSSA-N |
SMILES | [2H]C([2H])(C)C([2H])(C([2H])([2H])C)N |