For research use only. Not for therapeutic Use.
Pentanedioyl dichloride(Cat No.:L007023), is a chemical compound. Also known as glutaryl chloride, it consists of a pentanedioyl (glutaroyl) group and two chloride (Cl-) atoms. This compound is primarily used in organic synthesis as a versatile acylating agent. It participates in various reactions, such as the formation of amides and esters, making it crucial in the production of pharmaceuticals, agrochemicals, and polymers. Its reactivity and functionality enable the creation of complex organic molecules, making it valuable in research, especially in the pharmaceutical and chemical industries, for the development of diverse chemical compounds.
CAS Number | 2873-74-7 |
Molecular Formula | C5H6Cl2O2 |
Purity | ≥95% |
IUPAC Name | pentanedioyl dichloride |
InChI | InChI=1S/C5H6Cl2O2/c6-4(8)2-1-3-5(7)9/h1-3H2 |
InChIKey | YVOFTMXWTWHRBH-UHFFFAOYSA-N |
SMILES | C(CC(=O)Cl)CC(=O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |