For research use only. Not for therapeutic Use.
Pentanoic-d4 Acid(Cat No.:M072570) is a high-purity, deuterium-labeled compound essential for advanced biochemical and pharmaceutical research. Featuring four deuterium atoms, this isotopically labeled version of Pentanoic Acid is crucial for studies on fatty acid metabolism, biochemical pathways, and organic synthesis. Pentanoic-d4 Acid aids in the development of therapeutic agents and enhances the understanding of metabolic processes and biochemical mechanisms, making it a valuable tool for scientific investigations and drug development.
CAS Number | 1219804-71-3 |
Synonyms | Pentanoic–d4 Acid |
Molecular Formula | C5H10O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,2,3,3-tetradeuteriopentanoic acid |
InChI | InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7)/i3D2,4D2 |
InChIKey | NQPDZGIKBAWPEJ-KHORGVISSA-N |
SMILES | [2H]C([2H])(CC)C([2H])([2H])C(=O)O |