For research use only. Not for therapeutic Use.
Pentasodium diethylenetriaminepentaacetate (Cat No.:M067218) is a chelating agent often used in industrial processes and as a water treatment chemical. it possesses five sodium ions bound to a central organic molecule. Its structure allows it to form stable complexes with metal ions, making it effective in sequestering metal contaminants in water and soil. DTPA finds applications in diverse fields including agriculture, pharmaceuticals, and cleaning products. Its ability to bind with metal ions makes it valuable in removing heavy metals from industrial wastewater and preventing their adverse environmental impacts.
Catalog Number | M067218 |
CAS Number | 140-01-2 |
Molecular Formula | C14H18N3Na5O10 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | pentasodium;2-[bis[2-[bis(carboxylatomethyl)amino]ethyl]amino]acetate |
InChI | InChI=1S/C14H23N3O10.5Na/c18-10(19)5-15(1-3-16(6-11(20)21)7-12(22)23)2-4-17(8-13(24)25)9-14(26)27;;;;;/h1-9H2,(H,18,19)(H,20,21)(H,22,23)(H,24,25)(H,26,27);;;;;/q;5*+1/p-5 |
InChIKey | LQPLDXQVILYOOL-UHFFFAOYSA-I |
SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CCN(CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[Na+].[Na+].[Na+].[Na+].[Na+] |