For research use only. Not for therapeutic Use.
Pentolinium tartrate(Cat No.:I008635)is a ganglionic blocker that was once used as an antihypertensive agent. It works by blocking the transmission of nerve signals at autonomic ganglia, leading to a reduction in both sympathetic and parasympathetic nerve activity. This causes a decrease in blood pressure, primarily by reducing peripheral vascular resistance. Pentolinium tartrate has largely been replaced by other more selective and effective antihypertensive medications due to its broad and non-selective action, which can lead to side effects like hypotension and tachycardia. It is mainly used in research settings to study autonomic nervous system function.
CAS Number | 52-62-0 |
Synonyms | Pentolinium Tartrate ; Pendine; Recuryl; Tensilest; Pentalinium tartrate; Pentolinium bitartrate; Tartrate, Pentolinium; Tartrate, Pentolonium;;1-methyl-1-[5-(1-methylpyrrolidin-1-ium-1-yl)pentyl]pyrrolidin-1-ium;(2R,3R)-2,3,4-trihydroxy-4-oxobutano |
Molecular Formula | C23H42N2O12 |
Purity | ≥95% |
Target | Nicotinic Antagonist |
Solubility | Soluble in DMSO, not in water |
Storage | -20°C |
IUPAC Name | 1-methyl-1-[5-(1-methylpyrrolidin-1-ium-1-yl)pentyl]pyrrolidin-1-ium;(2R,3R)-2,3,4-trihydroxy-4-oxobutanoate |
InChI | InChI=1S/C15H32N2.2C4H6O6/c1-16(12-6-7-13-16)10-4-3-5-11-17(2)14-8-9-15-17;2*5-1(3(7)8)2(6)4(9)10/h3-15H2,1-2H3;2*1-2,5-6H,(H,7,8)(H,9,10)/q+2;;/p-2/t;2*1-,2-/m.11/s1 |
InChIKey | HSMKTIKKPMTUQH-WBPXWQEISA-L |
SMILES | C[N+]1(CCCC1)CCCCC[N+]2(CCCC2)C.[C@@H]([C@H](C(=O)[O-])O)(C(=O)O)O.[C@@H]([C@H](C(=O)[O-])O)(C(=O)O)O |