Pentoxyverine(CAT: I034424) is a potent antitussive agent widely used in pharmaceutical research and development. This compound acts primarily as a cough suppressant by targeting peripheral and central mechanisms, effectively reducing cough reflex sensitivity. Its distinct pharmacological profile makes it valuable for exploring treatments for respiratory conditions. Pentoxyverine’s chemical stability and efficacy in various formulations ensure its suitability for both preclinical and clinical studies. Ideal for use in drug development, Pentoxyverine offers researchers a reliable tool for investigating cough-related disorders and exploring novel therapeutic applications.
| Catalog Number | I034424 |
| CAS Number | 77-23-6 |
| Synonyms | Pentoxyverine; UCB2543; UCB-2543; UCB 2543 |
| Molecular Formula | C20H31NO3 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 1-Phenylcyclopentanecarboxylic acid,2-(2-(diethylamino)ethoxy)ethyl ester |
| InChI | InChI=1S/C20H31NO3/c1-3-21(4-2)14-15-23-16-17-24-19(22)20(12-8-9-13-20)18-10-6-5-7-11-18/h5-7,10-11H,3-4,8-9,12-17H2,1-2H3 |
| InChIKey | CFJMRBQWBDQYMK-UHFFFAOYSA-N |
| SMILES | O=C(C1(C2=CC=CC=C2)CCCC1)OCCOCCN(CC)CC |
