For research use only. Not for therapeutic Use.
Pepstatin A (CAT: I002902) is a potent and reversible inhibitor of acid proteases, particularly cathepsins D and E. It acts by binding to the active site of these enzymes, preventing their proteolytic activity. Pepstatin A is commonly used in biochemical and cellular research to inhibit acid proteases and investigate their functions. It has been particularly valuable in studying the role of cathepsins in various biological processes, including protein degradation, autophagy, and immune response. Additionally, pepstatin A has been explored as a potential therapeutic agent for diseases involving excessive activity of acid proteases, such as certain cancers and neurodegenerative disorders.
| Catalog Number | I002902 |
| CAS Number | 26305-03-3 |
| Synonyms | Pepstatin; isovaleryl-DL-Val-DL-Val-Sta(3xi,4xi)-DL-Ala-Sta(3xi,4xi)-OH; 3-hydroxy-4-[2-[[3-hydroxy-6-methyl-4-[[3-methyl-2-[[3-methyl-2-(3-methylbutanoylamino)butanoyl]amino]butanoyl]amino]heptanoyl]amino]propanoylamino]-6-methylheptanoic acid |
| Molecular Formula | C₃₄H₆₃N₅O₉ |
| Purity | ≥95% |
| Target | Other Proteases |
| Solubility | DMSO: ≥ 25 mg/mL |
| Storage | Store at -20°C |
| InChI | InChI=1S/C35H64N4O9/c1-18(2)12-24(40)15-25(21(7)8)34(47)39-32(22(9)10)35(48)38-26(13-19(3)4)28(41)16-30(43)36-23(11)33(46)37-27(14-20(5)6)29(42)17-31(44)45/h18-23,25-29,32,41-42H,12-17H2,1-11H3,(H,36,43)(H,37,46)(H,38,48)(H,39,47)(H,44,45)/t23-,25-,26-,27 |
| InChIKey | FJJYRFSPJZDANJ-IJMJMNMJSA-N |
| SMILES | CC(C)CC(C(CC(=O)O)O)NC(=O)C(C)NC(=O)CC(C(CC(C)C)NC(=O)C(C(C)C)NC(=O)C(CC(=O)CC(C)C)C(C)C)O |
| Reference | <p> |
