For research use only. Not for therapeutic Use.
Pepstatin A（Cat No.:I002902）is a potent and specific inhibitor of aspartic proteases, such as pepsin, renin, and cathepsin D. It is a naturally occurring pentapeptide isolated from Streptomyces species and widely used in biochemical research to study protease activity and inhibition. By binding tightly to the active site of aspartic proteases, Pepstatin A prevents substrate cleavage, making it an essential tool in protease mechanism studies and drug discovery. Its role in investigating protease-related diseases, including cancer and neurodegenerative disorders, highlights its importance in pharmaceutical and enzymology research.
| Catalog Number | I002902 |
| CAS Number | 26305-03-3 |
| Synonyms | Pepstatin; isovaleryl-DL-Val-DL-Val-Sta(3xi,4xi)-DL-Ala-Sta(3xi,4xi)-OH; 3-hydroxy-4-[2-[[3-hydroxy-6-methyl-4-[[3-methyl-2-[[3-methyl-2-(3-methylbutanoylamino)butanoyl]amino]butanoyl]amino]heptanoyl]amino]propanoylamino]-6-methylheptanoic acid |
| Molecular Formula | C₃₄H₆₃N₅O₉ |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | DMSO: ≥ 25 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | (3S,4S)-3-hydroxy-4-[[(2S)-2-[[(3S,4S)-3-hydroxy-6-methyl-4-[[(2S)-3-methyl-2-[[(2S)-3-methyl-2-(3-methylbutanoylamino)butanoyl]amino]butanoyl]amino]heptanoyl]amino]propanoyl]amino]-6-methylheptanoic acid |
| InChI | InChI=1S/C34H63N5O9/c1-17(2)12-23(37-33(47)31(21(9)10)39-34(48)30(20(7)8)38-27(42)14-19(5)6)25(40)15-28(43)35-22(11)32(46)36-24(13-18(3)4)26(41)16-29(44)45/h17-26,30-31,40-41H,12-16H2,1-11H3,(H,35,43)(H,36,46)(H,37,47)(H,38,42)(H,39,48)(H,44,45)/t22-,23-,24-,25-,26-,30-,31-/m0/s1 |
| InChIKey | FAXGPCHRFPCXOO-LXTPJMTPSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC(C)C)[C@H](CC(=O)O)O)NC(=O)C[C@@H]([C@H](CC(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)CC(C)C)O |
| Reference | <p> |
