For research use only. Not for therapeutic Use.
Perastine (Cat No.: I014559) is a pharmacological agent studied for its potential effects on the central nervous system, particularly in neuropsychiatric and cardiovascular research. It interacts with neurotransmitter receptors, influencing mood regulation and autonomic functions. Researchers explore its role in conditions such as depression, anxiety, and hypertension. Perastine’s mechanism of action and bioavailability make it a valuable tool in studying neuropharmacology and cardiovascular modulation. Its potential therapeutic applications are being investigated for improving mental health and circulatory system disorders.
| CAS Number | 4960-10-5 |
| Synonyms | Perastine;;1-(2-(Diphenylmethoxy)-ethyl)piperidine |
| Molecular Formula | C20H25NO |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| InChI | InChI=1S/C20H25NO/c1-4-10-18(11-5-1)20(19-12-6-2-7-13-19)22-17-16-21-14-8-3-9-15-21/h1-2,4-7,10-13,20H,3,8-9,14-17H2 |
| InChIKey | ZVWXNGJQZCPYLK-UHFFFAOYSA-N |
| SMILES | N1(CCOC(C2=CC=CC=C2)C3=CC=CC=C3)CCCCC1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
