For research use only. Not for therapeutic Use.
Perfluoro-2-methyl-2-pentene(Cat No.:M047398), is a fluorinated organic compound known for its unique chemical properties. It belongs to the family of perfluorinated compounds, where all hydrogen atoms are replaced with fluorine atoms. This particular compound features a five-carbon pentene backbone with two methyl groups and all carbon atoms fully fluorinated. Perfluoro-2-methyl-2-pentene is used in various applications, including as a building block in the synthesis of specialty chemicals, surfactants, and fluorinated polymers.
CAS Number | 1584-03-8 |
Molecular Formula | C6F12 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,1,1,3,4,4,5,5,5-nonafluoro-2-(trifluoromethyl)pent-2-ene |
InChI | InChI=1S/C6F12/c7-2(3(8,9)6(16,17)18)1(4(10,11)12)5(13,14)15 |
InChIKey | FAEGGADNHFKDQX-UHFFFAOYSA-N |
SMILES | C(=C(C(C(F)(F)F)(F)F)F)(C(F)(F)F)C(F)(F)F |