For research use only. Not for therapeutic Use.
Perfluoro(2-methyl-3-oxahexanoic) acid(Cat No.:M058944), often abbreviated as PFO2HxA, is a synthetic perfluorinated compound known for its stability and resistance to degradation. This chemical features a fluorinated carbon chain and a carboxylic acid group, making it highly effective at repelling oil and water. It is primarily used in industrial applications such as coatings for fabrics, cookware, and other surfaces where non-stick properties are desirable.
CAS Number | 13252-13-6 |
Molecular Formula | C6HF11O3 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 2,3,3,3-tetrafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propanoic acid |
InChI | InChI=1S/C6HF11O3/c7-2(1(18)19,4(10,11)12)20-6(16,17)3(8,9)5(13,14)15/h(H,18,19) |
InChIKey | CSEBNABAWMZWIF-UHFFFAOYSA-N |
SMILES | C(=O)(C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F)O |