For research use only. Not for therapeutic Use.
Perfluorodecanoic Acid(Cat No.:R026973)is a synthetic perfluorinated carboxylic acid with a ten-carbon backbone fully fluorinated, making it highly resistant to chemical, thermal, and biological degradation. It is widely used in industrial applications, including the production of fluoropolymers, surfactants, and as a processing aid. However, its environmental persistence and bioaccumulation have raised concerns, leading to extensive research on its toxicological effects and environmental impact. Perfluorodecanoic Acid is studied for its potential role in disrupting metabolic processes and endocrine function, making it a critical compound in environmental and health research.
CAS Number | 335-76-2 |
Synonyms | Nonadecafluorodecanoic Acid; 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Nonadecafluorodecanoic Acid; Nonadecafluoro-n-decanoic Acid; Nonadecafluorodecanoic Acid; PFDA; Perfluoro-1-nonanecarboxylic Acid; Perfluoro-n-decanoic Acid; Perfluorocapric Acid; |
Molecular Formula | C10HF19O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid |
InChI | InChI=1S/C10HF19O2/c11-2(12,1(30)31)3(13,14)4(15,16)5(17,18)6(19,20)7(21,22)8(23,24)9(25,26)10(27,28)29/h(H,30,31) |
InChIKey | PCIUEQPBYFRTEM-UHFFFAOYSA-N |
SMILES | C(=O)(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |