For research use only. Not for therapeutic Use.
Perfluorodecylethyl Methacrylate (Cat No.:C001047) is a fluorinated organic compound. It is a methacrylate derivative with a perfluoroalkyl group, which imparts strong hydrophobic and oleophobic properties to materials when polymerized. This unique characteristic makes it valuable in creating water and oil-repellent coatings, paints, and surface treatments for various substrates. Additionally, its fluorinated nature contributes to thermal and chemical stability. Perfluorodecylethyl Methacrylate finds applications in industries like textiles, electronics, and coatings where the need for robust and repellent surfaces is essential.
| Catalog Number | C001047 |
| CAS Number | 2144-54-9 |
| Synonyms | 2-(Perfluorodecyl)ethyl Methacrylate; 1H,1H,2H,2H-Henicosafluorododec-1-yl Methacrylate; 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-Heneicosafluorododecyl Methacrylate; 2-Methyl-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-heneicosafluorododecyl-2-propenoic Acid Ester |
| Molecular Formula | C₁₆H₉F₂₁O₂ |
| Purity | ≥95% |
| Solubility | Chloroform (Soluble), Methanol (Sparingly) |
| Appearance | White to Off-White Sticky Solid to Low-Melting Solid |
| Storage | -20°C, Inert atmosphere, Light sensitive |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-henicosafluorododecyl 2-methylprop-2-enoate |
| InChI | InChI=1S/C16H9F21O2/c1-5(2)6(38)39-4-3-7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)13(29,30)14(31,32)15(33,34)16(35,36)37/h1,3-4H2,2H3 |
| InChIKey | FQHLOOOXLDQLPF-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCC(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| Reference | Howard, P., et al.: Environ. Sci. Technol., 44, 2277 (2010). |
