For research use only. Not for therapeutic Use.
Perfluorophenol(CAT: R021473) is a synthetic compound belonging to the class of perfluoroalkyl compounds. Its mode of action involves its unique chemical structure, where all hydrogen atoms in the phenol ring are substituted with fluorine atoms, resulting in a fully fluorinated molecule. Perfluorophenol exhibits hydrophobic and lipophobic properties due to the strong carbon-fluorine bonds, making it resistant to environmental degradation. Its applications include serving as a surfactant, emulsifier, and in various industrial processes, such as electronics manufacturing and coatings.
| Catalog Number | R021473 |
| CAS Number | 771-61-9 |
| Synonyms | 2,3,4,5,6-Pentafluorophenol; Hydroxypentafluorobenzene; NSC 21627; Pentafluorohydroxybenzene; Pentafluorophenol; Pentafluorophenol |
| Molecular Formula | C6HF5O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2,3,4,5,6-pentafluorophenol |
| InChI | InChI=1S/C6HF5O/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| InChIKey | XBNGYFFABRKICK-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)O |
