For research use only. Not for therapeutic Use.
Perilla alcohol (Cat.No:R072659) is a natural terpene found in the Perilla frutescens plant, commonly known as shiso. It possesses antioxidant, anti-inflammatory, and antimicrobial properties. Perilla alcohol is used in traditional medicine and food flavoring. It has potential applications in health and cosmetic products due to its beneficial effects on skin health and wellness.
| Catalog Number | R072659 |
| CAS Number | 536-59-4 |
| Molecular Formula | C10H16O |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | Store at 2-8°C |
| IUPAC Name | (4-prop-1-en-2-ylcyclohexen-1-yl)methanol |
| InChI | InChI=1S/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,10-11H,1,4-7H2,2H3 |
| InChIKey | NDTYTMIUWGWIMO-UHFFFAOYSA-N |
| SMILES | CC(=C)C1CCC(=CC1)CO |
