For research use only. Not for therapeutic Use.
Perindopril Erbumine(Cat No.:A000276)is an ACE inhibitor used to treat hypertension and heart failure. By inhibiting the angiotensin-converting enzyme, it reduces the production of angiotensin II, leading to vasodilation and decreased blood pressure. This action also alleviates the workload on the heart, making it beneficial for heart failure patients. Additionally, Perindopril Erbumine improves arterial elasticity and endothelial function, providing cardiovascular protection. It is well-tolerated and effective in reducing the risk of stroke, myocardial infarction, and cardiovascular mortality, making it a valuable option for long-term cardiovascular health management.
CAS Number | 107133-36-8 |
Synonyms | NA |
Molecular Formula | C19H32N2O5.C4H11N |
Purity | ≥95% |
Target | Epigenetics |
Solubility | Limited solubility |
Storage | 3 years -20C powder |
IUPAC Name | (2S,3aS,7aS)-1-[(2S)-2-[[(2S)-1-ethoxy-1-oxopentan-2-yl]amino]propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylic acid;2-methylpropan-2-amine |
InChI | InChI=1S/C19H32N2O5.C4H11N/c1-4-8-14(19(25)26-5-2)20-12(3)17(22)21-15-10-7-6-9-13(15)11-16(21)18(23)24;1-4(2,3)5/h12-16,20H,4-11H2,1-3H3,(H,23,24);5H2,1-3H3/t12-,13-,14-,15-,16-;/m0./s1 |
InChIKey | IYNMDWMQHSMDDE-MHXJNQAMSA-N |
SMILES | CCCC(C(=O)OCC)NC(C)C(=O)N1C2CCCCC2CC1C(=O)O.CC(C)(C)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |