For research use only. Not for therapeutic Use.
Perphenazine (Cat No.:A000002) is an antipsychotic medication belonging to the phenothiazine class, commonly used to treat schizophrenia, severe anxiety, and acute psychotic episodes. It works by blocking dopamine receptors in the brain, which helps alleviate symptoms like delusions, hallucinations, and agitation. Perphenazine is also used to manage nausea and vomiting in some cases. While effective, it can cause side effects such as sedation, extrapyramidal symptoms, and tardive dyskinesia. Monitoring is essential to minimize adverse reactions during long-term use.
| CAS Number | 58-39-9 |
| Synonyms | Perphenazine, Perphenazin, Trilafon, Etaperazine |
| Molecular Formula | C21H26ClN3OS |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 2-[4-[3-(2-chlorophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol |
| InChI | 1S/C21H26ClN3OS/c22-17-6-7-21-19(16-17)25(18-4-1-2-5-20(18)27-21)9-3-8-23-10-12-24(13-11-23)14-15-26/h1-2,4-7,16,26H,3,8-15H2 |
| InChIKey | RGCVKNLCSQQDEP-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)Cl)CCO |
