For research use only. Not for therapeutic Use.
Perphenazine-d4(Cat No.:S000443) is a deuterated version of perphenazine, where four hydrogen atoms are replaced with deuterium. This enhancement is used in pharmacokinetic and metabolic research to study the drug’s stability and degradation pathways. Perphenazine is an antipsychotic medication primarily used to treat schizophrenia and psychotic disorders. It functions by blocking dopamine receptors in the brain, which helps reduce symptoms such as hallucinations and delusions. The deuterated version, Perphenazine-d4, allows researchers to gain deeper insights into how perphenazine is processed by the body, which can inform the development of more effective treatment regimens.
CAS Number | 155593-75-2 |
Molecular Formula | C21H22D4ClN3OS |
Purity | ≥95% |
Target | Autophagy |
IUPAC Name | 2-[4-[3-(2-chloro-1,3,7,9-tetradeuteriophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol |
InChI | InChI=1S/C21H26ClN3OS/c22-17-6-7-21-19(16-17)25(18-4-1-2-5-20(18)27-21)9-3-8-23-10-12-24(13-11-23)14-15-26/h1-2,4-7,16,26H,3,8-15H2/i2D,4D,6D,16D |
InChIKey | RGCVKNLCSQQDEP-WNJORUDBSA-N |
SMILES | C1CN(CCN1CCCN2C3=CC=CC=C3SC4=C2C=C(C=C4)Cl)CCO |