For research use only. Not for therapeutic Use.
Petasin(Cat No.:M016872)is a naturally occurring sesquiterpene ester found in the plant Petasites hybridus, commonly known as butterbur. It is recognized for its anti-inflammatory, antispasmodic, and vasodilatory properties, making it a key bioactive compound in traditional and herbal medicine. Petasin is primarily studied for its potential in treating migraine headaches, allergic rhinitis, and other inflammatory conditions. Its mechanism of action involves inhibiting leukotriene synthesis and calcium channel activity, which helps reduce inflammation and smooth muscle contraction. Petasin’s therapeutic potential continues to be explored in pharmacological research.
Catalog Number | M016872 |
CAS Number | 26577-85-5 |
Synonyms | (Z)-2-Methyl-2-butenoic acid (1R)-1,2,3,4,6,7,8,8a-octahydro-1β,8aβ-dimethyl-7α-(1-methylethenyl)-6-oxonaphthalen-2α-yl ester;(Z)-2-Methyl-2-butenoic acid [(3S)-3α-isopropenyl-4aβ,5β-dimethyl-2,3,4,4a,5,6,7,8-octahydro-2-oxonaphthalene]-6α-yl ester;( |
Molecular Formula | C20H28O3 |
Purity | ≥95% |
IUPAC Name | [(1R,2R,7S,8aR)-1,8a-dimethyl-6-oxo-7-prop-1-en-2-yl-1,2,3,4,7,8-hexahydronaphthalen-2-yl] (Z)-2-methylbut-2-enoate |
InChI | InChI=1S/C20H28O3/c1-7-13(4)19(22)23-18-9-8-15-10-17(21)16(12(2)3)11-20(15,6)14(18)5/h7,10,14,16,18H,2,8-9,11H2,1,3-6H3/b13-7-/t14-,16-,18+,20+/m0/s1 |
InChIKey | ISTBXSFGFOYLTM-NZEDGPFZSA-N |
SMILES | CC=C(C)C(=O)OC1CCC2=CC(=O)C(CC2(C1C)C)C(=C)C |