For research use only. Not for therapeutic Use.
Petesicatib (RO5459072; RG-7625) is a cathepsin S inhibitor, used in research of immune diseases[1].
Petesicatib (Example 238) is a cathepsin S inhibitor, used in research of immune diseases[1].
| Catalog Number | I019542 |
| CAS Number | 1252637-35-6 |
| Synonyms | (2S,4R)-N-(1-cyanocyclopropyl)-4-[4-(1-methylpyrazol-4-yl)-2-(trifluoromethyl)phenyl]sulfonyl-1-[1-(trifluoromethyl)cyclopropanecarbonyl]pyrrolidine-2-carboxamide |
| Molecular Formula | C25H23F6N5O4S |
| Purity | ≥95% |
| InChI | InChI=1S/C25H23F6N5O4S/c1-35-11-15(10-33-35)14-2-3-19(17(8-14)24(26,27)28)41(39,40)16-9-18(20(37)34-22(13-32)4-5-22)36(12-16)21(38)23(6-7-23)25(29,30)31/h2-3,8,10-11,16,18H,4-7,9,12H2,1H3,(H,34,37)/t16-,18+/m1/s1 |
| InChIKey | KXAAIORSMACJSI-AEFFLSMTSA-N |
| SMILES | CN1C=C(C=N1)C2=CC(=C(C=C2)S(=O)(=O)C3CC(N(C3)C(=O)C4(CC4)C(F)(F)F)C(=O)NC5(CC5)C#N)C(F)(F)F |
| Reference | [1]. Rubén Alvarez Sánchez, et al. Novel proline derivatives. US20100267722A1 |
