For research use only. Not for therapeutic Use.
Petunidin chloride is an O-methylated anthocyanidin derived from delphinidin. Petunidin chloride binds with and suppresses the activity of focal adhesion kinase and to inhibit platelet-derived growth factor-induced aortic smooth muscle cell migration, which may confer a protective effect against atherosclerosis.
| Catalog Number | R044809 |
| CAS Number | 1429-30-7 |
| Synonyms | 2-(3,4-dihydroxy-5-methoxyphenyl)chromenylium-3,5,7-triol;chloride |
| Molecular Formula | C16H13ClO7 |
| Purity | ≥95% |
| InChI | InChI=1S/C16H12O7.ClH/c1-22-14-3-7(2-11(19)15(14)21)16-12(20)6-9-10(18)4-8(17)5-13(9)23-16;/h2-6H,1H3,(H4-,17,18,19,20,21);1H |
| InChIKey | QULMBDNPZCFSPR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1O)O)C2=[O+]C3=CC(=CC(=C3C=C2O)O)O.[Cl-] |
