For research use only. Not for therapeutic Use.
PF 00277343 is a thyroid receptor agonist that is used for the treatment of androgenetic alopecia.
| Catalog Number | I008643 |
| CAS Number | 332926-04-2 |
| Synonyms | PF 00277343; PF-00277343; PF00277343.;1,2,4-Triazine-3,5(2H,4H)-dione, 2-(4-(3-((4-fluorophenyl)methyl)-4-hydroxyphenoxy)-3,5-dimethylphenyl)- |
| Molecular Formula | C24H20FN3O4 |
| Purity | ≥95% |
| Target | thyroid receptor agonist |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 2-[4-[3-[(4-fluorophenyl)methyl]-4-hydroxyphenoxy]-3,5-dimethylphenyl]-1,2,4-triazine-3,5-dione |
| InChI | InChI=1S/C24H20FN3O4/c1-14-9-19(28-24(31)27-22(30)13-26-28)10-15(2)23(14)32-20-7-8-21(29)17(12-20)11-16-3-5-18(25)6-4-16/h3-10,12-13,29H,11H2,1-2H3,(H,27,30,31) |
| InChIKey | HQXKNHQWCAXRDN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC2=CC(=C(C=C2)O)CC3=CC=C(C=C3)F)C)N4C(=O)NC(=O)C=N4 |
