For research use only. Not for therapeutic Use.
PF-04457845 (Cat No.:000145) is a potent and highly selective inhibitor of fatty acid amide hydrolase (FAAH), an enzyme responsible for the degradation of endocannabinoids. By inhibiting FAAH, PF-04457845 increases the levels of endocannabinoids, such as anandamide, which can modulate pain and inflammation. In animal studies, PF-04457845 has demonstrated analgesic and anti-inflammatory effects comparable to naproxen, a nonsteroidal anti-inflammatory drug (NSAID). These findings suggest that PF-04457845 has the potential as a therapeutic agent for the treatment of pain and inflammatory conditions.
| Catalog Number | I000145 |
| CAS Number | 1020315-31-4 |
| Synonyms | N-pyridazin-3-yl-4-[[3-[5-(trifluoromethyl)pyridin-2-yl]oxyphenyl]methylidene]piperidine-1-carboxamide |
| Molecular Formula | C23H20F3N5O2 |
| Purity | ≥95% |
| Target | FAAH |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 7.2 nM |
| IUPAC Name | N-pyridazin-3-yl-4-[[3-[5-(trifluoromethyl)pyridin-2-yl]oxyphenyl]methylidene]piperidine-1-carboxamide |
| InChI | InChI=1S/C23H20F3N5O2/c24-23(25,26)18-6-7-21(27-15-18)33-19-4-1-3-17(14-19)13-16-8-11-31(12-9-16)22(32)29-20-5-2-10-28-30-20/h1-7,10,13-15H,8-9,11-12H2,(H,29,30,32) |
| InChIKey | BATCTBJIJJEPHM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=CC2=CC(=CC=C2)OC3=NC=C(C=C3)C(F)(F)F)C(=O)NC4=NN=CC=C4 |
| Reference | <br /> |
