For research use only. Not for therapeutic Use.
PF06650833(CAT: I002359) is an inhibitor of Interleukin-1 receptor-associated kinase 4 (IRAK4). It is a small molecule drug that specifically targets IRAK4, which plays a crucial role in the signaling pathways of the innate immune system. By inhibiting IRAK4, PF06650833 can modulate the inflammatory response and immune system activity. This makes it a potential therapeutic option for the treatment of various diseases characterized by dysregulated immune responses, such as rheumatoid arthritis, lupus, and lymphomas.
CAS Number | 1817626-54-2 |
Synonyms | PF-06650833; 1-[[(2S,3S,4S)-3-Ethyl-4-fluoro-5-oxo-2-pyrrolidinyl]methoxy]-7-methoxy-6-isoquinolinecarboxamide |
Molecular Formula | C₁₈H₂₀FN₃O₄ |
Purity | ≥95% |
Target | IRAK |
Solubility | DMSO: ≥ 33 mg/mL |
Storage | Store at -20°C |
InChI | InChI=1S/C18H20FN3O4/c1-3-10-13(22-17(24)15(10)19)8-26-18-11-7-14(25-2)12(16(20)23)6-9(11)4-5-21-18/h4-7,10,13,15H,3,8H2,1-2H3,(H2,20,23)(H,22,24)/t10-,13+,15-/m0/s1 |
SMILES | O=C(C1=CC2=C(C(OC[[email protected]]([[email protected]](CC)[[email protected]@H]3F)NC3=O)=NC=C2)C=C1OC)N |
Reference | 1. Expert Opin Ther Pat. 2016 Aug;26(8):917-32. doi: 10.1080/13543776.2016.1202926. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |