For research use only. Not for therapeutic Use.
PF-219061（Cat No.:I012302）is a small-molecule inhibitor designed to target the protein kinase CK1δ (casein kinase 1 delta). CK1δ plays a critical role in regulating various cellular processes, including circadian rhythms, DNA repair, and cell signaling. PF-219061 selectively inhibits CK1δ activity, making it a potential therapeutic candidate for disorders related to abnormal CK1δ function, such as cancer, neurodegenerative diseases, and mood disorders. Its application in clinical research aims to explore its effects on the modulation of circadian rhythms and the treatment of diseases driven by dysregulated CK1δ signaling.
| Catalog Number | I012302 |
| CAS Number | 710654-74-3 |
| Synonyms | (R)-3-(4-Propylmorpholin-2-yl)phenol |
| Molecular Formula | C13H19NO2 |
| Purity | ≥95% |
| IUPAC Name | 3-[(2R)-4-propylmorpholin-2-yl]phenol |
| InChI | InChI=1S/C13H19NO2/c1-2-6-14-7-8-16-13(10-14)11-4-3-5-12(15)9-11/h3-5,9,13,15H,2,6-8,10H2,1H3/t13-/m0/s1 |
| InChIKey | WYEGTIGJSHGEID-ZDUSSCGKSA-N |
| SMILES | CCCN1CCO[C@@H](C1)C2=CC(=CC=C2)O |
