For research use only, not for therapeutic use.
PF-573228（Cat No.:I005228）is a potent and selective inhibitor of focal adhesion kinase (FAK), a key regulator of cell adhesion, migration, and survival. By targeting FAK, PF-573228 disrupts signaling pathways involved in cancer cell proliferation and metastasis, making it a valuable tool in cancer research. This inhibitor has been shown to impair the growth of tumors by reducing their ability to form new blood vessels and invade surrounding tissues. PF-573228 is widely used in preclinical studies to explore FAK’s role in cancer progression and other diseases related to cellular migration and adhesion.
| Catalog Number | I005228 |
| CAS Number | 869288-64-2 |
| Synonyms | 6-[[4-[(3-methylsulfonylphenyl)methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3,4-dihydro-1H-quinolin-2-one |
| Molecular Formula | C₂₂H₂₀F₃N₅O₃S |
| Purity | ≥95% |
| Target | FAK |
| Solubility | DMSO: ≥ 51 mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 4 nM |
| IUPAC Name | 6-[[4-[(3-methylsulfonylphenyl)methylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3,4-dihydro-1H-quinolin-2-one |
| InChI | InChI=1S/C22H20F3N5O3S/c1-34(32,33)16-4-2-3-13(9-16)11-26-20-17(22(23,24)25)12-27-21(30-20)28-15-6-7-18-14(10-15)5-8-19(31)29-18/h2-4,6-7,9-10,12H,5,8,11H2,1H3,(H,29,31)(H2,26,27,28,30) |
| InChIKey | HESLKTSGTIBHJU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC(=C1)CNC2=NC(=NC=C2C(F)(F)F)NC3=CC4=C(C=C3)NC(=O)CC4 |
| Reference | <p> |
