For research use only. Not for therapeutic Use.
PF-9366(CAT: I014567) is a novel inhibitor specifically targeting human methionine adenosyltransferase 2A (Mat2A), an isoform primarily found outside the liver. By inhibiting Mat2A, PF-9366 has the potential to modulate methionine metabolism and related pathways. This inhibition could have implications in various cellular processes, particularly those involving methylation and methyl donor availability.
| Catalog Number | I014567 |
| CAS Number | 72882-78-1 |
| Synonyms | PF-9366; PF 9366; PF9366.;2-(7-Chloro-5-phenyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)-N,N-dimethylethan-1-amine |
| Molecular Formula | C20H19ClN4 |
| Purity | ≥95% |
| Target | Mat2A inhibitor |
| Solubility | Soluble in DMSO |
| InChI | InChI=1S/C20H19ClN4/c1-24(2)11-10-19-22-23-20-13-16(14-6-4-3-5-7-14)17-12-15(21)8-9-18(17)25(19)20/h3-9,12-13H,10-11H2,1-2H3 |
| InChIKey | LYLASWLQCMKZAT-UHFFFAOYSA-N |
| SMILES | CN(C)CCC1=NN=C2N1C3=C(C=C(Cl)C=C3)C(C4=CC=CC=C4)=C2 |
| Reference | </br>1: Quinlan CL, Kaiser SE, Bolaños B, Nowlin D, Grantner R, Karlicek-Bryant S, Feng JL, Jenkinson S, Freeman-Cook K, Dann SG, Wang X, Wells PA, Fantin VR, Stewart AE, Grant SK. Targeting S-adenosylmethionine biosynthesis with a novel allosteric inhibitor of Mat2A. Nat Chem Biol. 2017 May 29. doi: 10.1038/nchembio.2384. [Epub ahead of print] PubMed PMID: 28553945.</br></br> |
