For research use only. Not for therapeutic Use.
PF-06747775(CAT: I010182) is an orally available inhibitor that specifically targets the mutant form of the epidermal growth factor receptor (EGFR) known as T790M. This compound has potential antineoplastic activity, meaning it may be effective in treating certain types of cancer. PF-06747775 demonstrates potent activity against the four common EGFR mutant forms, including exon 19 deletion (Del), L858R, and the double mutants T790M/L858R and T790M/Del. It exhibits selectivity for the mutant EGFR while sparing the wild-type EGFR. Additionally, PF-06747775 possesses desirable absorption, distribution, metabolism, and excretion (ADME) properties, which are important considerations for its therapeutic potential.
| Catalog Number | I010182 |
| CAS Number | 1776112-90-3 |
| Synonyms | N-((3R,4R)-4-fluoro-1-(6-((3-methoxy-1-methyl-1H-pyrazol-4-yl)amino)-9-methyl-9H-purin-2-yl)pyrrolidin-3-yl)acrylamide |
| Molecular Formula | C18H22FN9O2 |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Storage | 0 - 4 °C |
| IUPAC Name | N-[(3R,4R)-4-fluoro-1-[6-[(3-methoxy-1-methylpyrazol-4-yl)amino]-9-methylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide |
| InChI | InChI=1S/C18H22FN9O2/c1-5-13(29)21-11-8-28(6-10(11)19)18-23-15(14-16(24-18)26(2)9-20-14)22-12-7-27(3)25-17(12)30-4/h5,7,9-11H,1,6,8H2,2-4H3,(H,21,29)(H,22,23,24)/t10-,11-/m1/s1 |
| InChIKey | JYIUNVOCEFIUIU-GHMZBOCLSA-N |
| SMILES | CN1C=C(C(=N1)OC)NC2=NC(=NC3=C2N=CN3C)N4CC(C(C4)F)NC(=O)C=C |
