For research use only. Not for therapeutic Use.
PF74(Cat No.:I012301)is a small-molecule inhibitor that targets the HIV-1 capsid protein, disrupting essential viral replication processes. By binding to the interface between capsid subunits, PF74 interferes with capsid stability and its interaction with host proteins, such as CPSF6 and NUP153, crucial for nuclear import and uncoating. This dual mechanism makes PF74 a valuable tool in studying HIV-1 capsid dynamics and host-virus interactions. Although primarily used in research, its unique mode of action highlights potential therapeutic pathways for developing innovative antiretroviral drugs targeting capsid function.
CAS Number | 1352879-65-2 |
Synonyms | PF-3450074; 2-Methyl-N-[(1S)-2-(methylphenylamino)-2-oxo-1-(phenylmethyl)ethyl]-1H-Indole-3-acetamide |
Molecular Formula | C27H27N3O2 |
Purity | ≥95% |
Target | HIV |
IUPAC Name | (2S)-N-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]-N,3-diphenylpropanamide |
InChI | InChI=1S/C27H27N3O2/c1-19-23(22-15-9-10-16-24(22)28-19)18-26(31)29-25(17-20-11-5-3-6-12-20)27(32)30(2)21-13-7-4-8-14-21/h3-16,25,28H,17-18H2,1-2H3,(H,29,31)/t25-/m0/s1 |
InChIKey | ACDFWSNAQWFRRF-VWLOTQADSA-N |
SMILES | CC1=C(C2=CC=CC=C2N1)CC(=O)N[C@@H](CC3=CC=CC=C3)C(=O)N(C)C4=CC=CC=C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |