For research use only. Not for therapeutic Use.
PF74 (Cat.No:I012301) is a small molecule inhibitor that targets the capsid protein of the human immunodeficiency virus type 1 (HIV-1). It disrupts the early stages of HIV-1 replication by preventing the capsid protein from properly assembling, hindering viral infection. PF74 shows potential as a therapeutic agent against HIV-1 and is being investigated for its antiviral properties.
| Catalog Number | I012301 |
| CAS Number | 1352879-65-2 |
| Synonyms | PF-3450074; 2-Methyl-N-[(1S)-2-(methylphenylamino)-2-oxo-1-(phenylmethyl)ethyl]-1H-Indole- 3-acetamide |
| Molecular Formula | C27H27N3O2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-N-methyl-2-[[2-(2-methyl-1H-indol-3-yl)acetyl]amino]-N,3-diphenylpropanamide |
| InChI | InChI=1S/C27H27N3O2/c1-19-23(22-15-9-10-16-24(22)28-19)18-26(31)29-25(17-20-11-5-3-6-12-20)27(32)30(2)21-13-7-4-8-14-21/h3-16,25,28H,17-18H2,1-2H3,(H,29,31)/t25-/m0/s1 |
| InChIKey | ACDFWSNAQWFRRF-VWLOTQADSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)CC(=O)NC(CC3=CC=CC=C3)C(=O)N(C)C4=CC=CC=C4 |
