For research use only. Not for therapeutic Use.
PFE-360 (Cat.No:I018744) is a selective, orally bioavailable inhibitor of the protein kinase Akt. It targets the Akt pathway, which plays a key role in cell survival, growth, and metabolism, particularly in cancer. By inhibiting Akt, PFE-360 aims to disrupt tumor cell proliferation and survival, making it a potential therapeutic candidate in cancer treatment. It is being explored in clinical research to assess its efficacy and safety, especially in tumors with activated Akt signaling pathways, such as certain breast, lung, and ovarian cancers.
| Catalog Number | I018744 |
| CAS Number | 1527475-61-1 |
| Molecular Formula | C₁₆H₁₆N₆O |
| Purity | ≥95% |
| Target | LRRK2 |
| IUPAC Name | 1-methyl-4-(4-morpholin-4-yl-7H-pyrrolo[2,3-d]pyrimidin-5-yl)pyrrole-2-carbonitrile |
| InChI | 1S/C16H16N6O/c1-21-9-11(6-12(21)7-17)13-8-18-15-14(13)16(20-10-19-15)22-2-4-23-5-3-22/h6,8-10H,2-5H2,1H3,(H,18,19,20) |
| InChIKey | IYQTYHISVSPMSU-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=C1C#N)C2=CNC3=C2C(=NC=N3)N4CCOCC4 |
