For research use only. Not for therapeutic Use.
PFI-2 hydrochloride(Cat No.:I002099), is a chemical compound with significance in the field of epigenetics and molecular biology. It functions as a potent and selective inhibitor targeting a specific class of enzymes known as SETD7, which are responsible for adding methyl groups to histone proteins. By inhibiting SETD7, PFI-2 hydrochloride has the potential to modulate epigenetic regulation, impacting gene expression and cellular processes.
CAS Number | 1627607-87-7 |
Synonyms | (R)-8-fluoro-N-(1-oxo-1-(pyrrolidin-1-yl)-3-(3-(trifluoromethyl)phenyl)propan-2-yl)-1,2,3,4-tetrahydroisoquinoline-6-sulfonamide hydrochloride |
Molecular Formula | C23H25F4N3O3S • HCl |
Purity | ≥95% |
Target | Histone Methyltransferase |
Solubility | DMSO: ≥ 32 mg/mL |
Storage | 2-8°C |
IC50 | 2 nM |
IUPAC Name | 8-fluoro-N-[(2R)-1-oxo-1-pyrrolidin-1-yl-3-[3-(trifluoromethyl)phenyl]propan-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-sulfonamide;hydrochloride |
InChI | InChI=1S/C23H25F4N3O3S.ClH/c24-20-13-18(12-16-6-7-28-14-19(16)20)34(32,33)29-21(22(31)30-8-1-2-9-30)11-15-4-3-5-17(10-15)23(25,26)27;/h3-5,10,12-13,21,28-29H,1-2,6-9,11,14H2;1H/t21-;/m1./s1 |
InChIKey | ZADKZNVAJGEFLC-ZMBIFBSDSA-N |
SMILES | C1CCN(C1)C(=O)C(CC2=CC(=CC=C2)C(F)(F)F)NS(=O)(=O)C3=CC4=C(CNCC4)C(=C3)F.Cl |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |