For research use only. Not for therapeutic Use.
PFI-2(Cat No.:I002101)is a small molecule inhibitor designed to target the protein Brd4, a member of the bromodomain and extra-terminal (BET) family. Brd4 plays a crucial role in regulating gene expression and is involved in the transcriptional activation of various genes, including those associated with cancer cell growth and survival. By inhibiting Brd4, PFI-2 is being investigated for its potential therapeutic effects in cancer, particularly in hematological malignancies and solid tumors. Preclinical studies have shown that PFI-2 can reduce tumor growth and increase sensitivity to other cancer therapies, though further clinical trials are needed.
CAS Number | 1627676-59-8 |
Synonyms | 8-fluoro-N-[(2R)-1-oxo-1-pyrrolidin-1-yl-3-[3-(trifluoromethyl)phenyl]propan-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-sulfonamide |
Molecular Formula | C₂₃H₂₅F₄N₃O₃S |
Purity | ≥95% |
Target | Histone Methyltransferase |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | 2 nM |
IUPAC Name | 8-fluoro-N-[(2R)-1-oxo-1-pyrrolidin-1-yl-3-[3-(trifluoromethyl)phenyl]propan-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-sulfonamide |
InChI | InChI=1S/C23H25F4N3O3S/c24-20-13-18(12-16-6-7-28-14-19(16)20)34(32,33)29-21(22(31)30-8-1-2-9-30)11-15-4-3-5-17(10-15)23(25,26)27/h3-5,10,12-13,21,28-29H,1-2,6-9,11,14H2/t21-/m1/s1 |
InChIKey | JCKGSPAAPQRPBW-OAQYLSRUSA-N |
SMILES | C1CCN(C1)C(=O)[C@@H](CC2=CC(=CC=C2)C(F)(F)F)NS(=O)(=O)C3=CC4=C(CNCC4)C(=C3)F |
Reference | <p style=/line-height:25px/> </p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |