For research use only. Not for therapeutic Use.
PFK-158 (Cat.No:I001771) is a small molecule inhibitor that targets phosphofructokinase-1 (PFK-1), a key enzyme involved in glycolysis. By inhibiting PFK-1, PFK-158 disrupts the metabolic pathways of cancer cells, leading to energy depletion and impaired tumor growth. It shows promise as a potential anticancer therapy and is currently being investigated in preclinical studies.
CAS Number | 1462249-75-7 |
Molecular Formula | C18H11F3N2O |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 30 mg/mL |
Storage | -20°C |
IUPAC Name | (E)-1-pyridin-4-yl-3-[7-(trifluoromethyl)quinolin-2-yl]prop-2-en-1-one |
InChI | 1S/C18H11F3N2O/c19-18(20,21)14-3-1-12-2-4-15(23-16(12)11-14)5-6-17(24)13-7-9-22-10-8-13/h1-11H/b6-5+ |
InChIKey | IAJOMYABKVAZCN-AATRIKPKSA-N |
SMILES | C1=CC(=CC2=C1C=CC(=N2)/C=C/C(=O)C3=CC=NC=C3)C(F)(F)F |