For research use only. Not for therapeutic Use.
PFKFB3-IN-2 is a 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3 (PFKFB3) inhibitor. PFKFB3-IN-2 has potential applications in cancer, neurodegenerative diseases, autoimmune diseases, inflammatory diseases, multiple sclerosis, metabolic diseases, angiogenesis inhibition and other diseases[1].
| Catalog Number | I041707 |
| CAS Number | 794552-84-4 |
| Synonyms | 4-[(3-carboxyphenyl)sulfonylamino]-2-hydroxybenzoic acid |
| Molecular Formula | C14H11NO7S |
| Purity | ≥95% |
| InChI | InChI=1S/C14H11NO7S/c16-12-7-9(4-5-11(12)14(19)20)15-23(21,22)10-3-1-2-8(6-10)13(17)18/h1-7,15-16H,(H,17,18)(H,19,20) |
| InChIKey | NGXAGADOESECAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NC2=CC(=C(C=C2)C(=O)O)O)C(=O)O |
| Reference | [1]. Fedichev P, et al. Pfkfb3 inhibitors and their uses. World Intellectual Property Organization. WO2020080979. |
