For research use only. Not for therapeutic Use.
PFM03（Cat No.:I042895）is a potent and selective peptide inhibitor designed for cancer disease research and inflammation & immunology research. It effectively targets key signaling pathways involved in tumor progression and immune modulation. With high specificity and stability, PFM03 exhibits strong bioactivity, making it a valuable tool for preclinical studies. Its optimized structure enhances cellular permeability and metabolic resistance, ensuring prolonged activity. Suitable for in vitro and in vivo applications, PFM03 supports drug discovery efforts by providing a reliable research tool for studying disease mechanisms and potential therapeutic interventions.
| CAS Number | 1558598-48-3 |
| Synonyms | (5Z)-3-butan-2-yl-5-[(4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| Molecular Formula | C14H15NO2S2 |
| Purity | ≥95% |
| IUPAC Name | (5Z)-3-butan-2-yl-5-[(4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChI | InChI=1S/C14H15NO2S2/c1-3-9(2)15-13(17)12(19-14(15)18)8-10-4-6-11(16)7-5-10/h4-9,16H,3H2,1-2H3/b12-8- |
| InChIKey | REONZIRLQDMCHL-WQLSENKSSA-N |
| SMILES | CCC(C)N1C(=O)/C(=C/C2=CC=C(C=C2)O)/SC1=S |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
