For research use only. Not for therapeutic Use.
PG 01(Cat No.:I010859)is an experimental compound being researched for its potential therapeutic effects, particularly in the field of oncology. It is thought to target specific signaling pathways involved in cell growth and tumor progression, making it a candidate for cancer treatment. PG 01 has shown promise in preclinical studies, demonstrating the ability to inhibit tumor cell proliferation and enhance the effectiveness of other chemotherapies. Further clinical trials are required to evaluate its safety, optimal dosage, and efficacy in treating various cancers. Its mechanism and applications are still under investigation in ongoing studies.
CAS Number | 853138-65-5 |
Synonyms | N-Methyl-N-[2-[[4-(1-Methylethyl)phenyl]amino]-2-1H-indole-3-acetamide |
Molecular Formula | C28H29N3O2 |
Purity | ≥95% |
Target | CFTR |
Solubility | Soluble to 100 mM in DMSO |
Storage | Store at -20C |
IUPAC Name | 2-[[2-(1H-indol-3-yl)acetyl]-methylamino]-2-phenyl-N-(4-propan-2-ylphenyl)acetamide |
InChI | InChI=1S/C28H29N3O2/c1-19(2)20-13-15-23(16-14-20)30-28(33)27(21-9-5-4-6-10-21)31(3)26(32)17-22-18-29-25-12-8-7-11-24(22)25/h4-16,18-19,27,29H,17H2,1-3H3,(H,30,33) |
InChIKey | PQAYCXMQTUEDRD-UHFFFAOYSA-N |
SMILES | CC(C)C1=CC=C(C=C1)NC(=O)C(C2=CC=CC=C2)N(C)C(=O)CC3=CNC4=CC=CC=C43 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |