For research use only. Not for therapeutic Use.
Cystic fibrosis transmembrane conductance regulator (CFTR) potentiator. Corrects gating defects of CFTR mutants such as <span class=/’symbol/’>Δ</span>F508 (K<sub>a</sub> = 0.3 <span class=/’symbol/’>μ</span>M), E193K and G970R (K<sub>d</sub> values are 0.22 <span class=/’symbol/’>μ</span>M and 0.45 <span class=/’symbol/’>μ</span>M respectively). Increases <span class=/’symbol/’>Δ</span>F508-CFTR Cl<sup>-</sup> currents in the presence of forskolin; displays no effect on Ca<sup>2+</sup>-activated Cl<sup>-</sup> current.
| Catalog Number | I010859 |
| CAS Number | 853138-65-5 |
| Synonyms | N-Methyl-N-[2-[[4-(1-Methylethyl)phenyl]amino]-2-1H-indole-3-acetamide |
| Molecular Formula | C28H29N3O2 |
| Purity | ≥95% |
| Target | CFTR |
| Solubility | Soluble to 100 mM in DMSO |
| Storage | Store at -20C |
| IUPAC Name | 2-[[2-(1H-indol-3-yl)acetyl]-methylamino]-2-phenyl-N-(4-propan-2-ylphenyl)acetamide |
| InChI | InChI=1S/C28H29N3O2/c1-19(2)20-13-15-23(16-14-20)30-28(33)27(21-9-5-4-6-10-21)31(3)26(32)17-22-18-29-25-12-8-7-11-24(22)25/h4-16,18-19,27,29H,17H2,1-3H3,(H,30,33) |
| InChIKey | PQAYCXMQTUEDRD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)NC(=O)C(C2=CC=CC=C2)N(C)C(=O)CC3=CNC4=CC=CC=C43 |
