For research use only. Not for therapeutic Use.
PGN36（Cat No.:I043687）is a targeted therapeutic agent designed to inhibit specific cancer cell signaling pathways, particularly in tumors with high expression of certain oncogenic proteins. It works by selectively targeting and modulating the activity of key molecular drivers involved in tumor progression, cell survival, and metastasis. PGN36 has demonstrated potential in preclinical studies as an effective treatment for various cancers, including those resistant to traditional therapies. With its ability to disrupt tumorigenic signaling, PGN36 is being explored as a novel strategy in precision medicine for cancer treatment, aiming to improve patient outcomes and survival.
| CAS Number | 1564253-75-3 |
| Synonyms | 1-benzyl-3-(cyclohexylmethoxy)-5-nitroindazole |
| Molecular Formula | C21H23N3O3 |
| Purity | ≥95% |
| IUPAC Name | 1-benzyl-3-(cyclohexylmethoxy)-5-nitroindazole |
| InChI | InChI=1S/C21H23N3O3/c25-24(26)18-11-12-20-19(13-18)21(27-15-17-9-5-2-6-10-17)22-23(20)14-16-7-3-1-4-8-16/h1,3-4,7-8,11-13,17H,2,5-6,9-10,14-15H2 |
| InChIKey | VLMJWSVJQMZYSE-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)COC2=NN(C3=C2C=C(C=C3)[N+](=O)[O-])CC4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
