For research use only. Not for therapeutic Use.
Catalog Number | M010397 |
CAS Number | 84-12-8 |
Synonyms | 4,7-phenanthroline-5,6-dione;phanquinone;phanquone;4,7-phenanthrolene-5,6-quinone;enthohex;entobex;C-11925;Ciba 11925 |
Molecular Formula | C12H6N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4,7-phenanthroline-5,6-dione |
InChI | InChI=1S/C12H6N2O2/c15-11-9-7(3-1-5-13-9)8-4-2-6-14-10(8)12(11)16/h1-6H |
InChIKey | VLPADTBFADIFKG-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C(=O)C(=O)C3=C2C=CC=N3)N=C1 |
Reference | 1: Gioia MG, Gatti R, Minarini A. LC determination of leuprolide component amino 2: Gatti R, Gioia MG, Andreatta P, Pentassuglia G. HPLC-fluorescence <br> 4: Gatti R, Gioia MG. Liquid chromatographic fluorescence determination of amino 5: Chaiyabutr N, Tesprateep T, Loypetjra P, Pichaicharnarong A. Urinary bladder |