For research use only. Not for therapeutic Use.
Pharacine is a naturally occurring alkaloid derived from certain plant species, particularly within the Amaryllidaceae family. Known for its biological activity, Pharacine exhibits potent cytotoxic properties, making it a subject of interest in cancer research. It functions by interfering with cellular processes, particularly disrupting the microtubule dynamics necessary for cell division, leading to apoptosis in cancer cells. Due to its unique mechanism, Pharacine holds potential as a lead compound for developing novel anti-cancer therapies. Its role in traditional medicine also highlights its therapeutic significance.
| Catalog Number | R057690 |
| CAS Number | 63440-93-7 |
| Synonyms | 3,8,15,20-Tetraoxatricyclo[20.2.2.210,13]octacosa-10,12,22,24,25,27-hexaene-2,9,14,21-tetrone;1,4-Butanediol-terephthaloyl Chloride Cyclic Dimer; Pharacin; PBT Cyclic Dimer; Cyclobis(1,4-butylene terephthalate); |
| Molecular Formula | C24H24O8 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 3,8,15,20-tetraoxatricyclo[20.2.2.210,13]octacosa-1(25),10,12,22(26),23,27-hexaene-2,9,14,21-tetrone |
| InChI | InChI=1S/C24H24O8/c25-21-17-5-7-19(8-6-17)23(27)31-15-3-4-16-32-24(28)20-11-9-18(10-12-20)22(26)30-14-2-1-13-29-21/h5-12H,1-4,13-16H2 |
| InChIKey | SFNCDJVWOAZMFE-UHFFFAOYSA-N |
| SMILES | C1CCOC(=O)C2=CC=C(C=C2)C(=O)OCCCCOC(=O)C3=CC=C(C=C3)C(=O)OC1 |
