For research use only. Not for therapeutic Use.
Phaseic acid is a Abscisic acid terpenoid catabolite that can able to activate a subset of Abscisic acid repectors. Phaseic acid is a plant hormone associated with photosynthesis arrest and abscission[1].
| Catalog Number | I042505 |
| CAS Number | 24394-14-7 |
| Synonyms | (2Z,4E)-5-[(1R,5R,8S)-8-hydroxy-1,5-dimethyl-3-oxo-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid |
| Molecular Formula | C15H20O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C15H20O5/c1-10(6-12(17)18)4-5-15(19)13(2)7-11(16)8-14(15,3)20-9-13/h4-6,19H,7-9H2,1-3H3,(H,17,18)/b5-4+,10-6-/t13-,14-,15+/m1/s1 |
| InChIKey | IZGYIFFQBZWOLJ-UUZREKTLSA-N |
| SMILES | CC(=CC(=O)O)C=CC1(C2(CC(=O)CC1(OC2)C)C)O |
| Reference | [1]. Pedro L Rodriguez, et al. Abscisic Acid Catabolism Generates Phaseic Acid, a Molecule Able to Activate a Subset of ABA Receptors. Mol Plant. 2016 Nov 7;9(11):1448-1450. |
