For research use only. Not for therapeutic Use.
Phaseic acid(Cat No.:I042505)is a naturally occurring compound and a derivative of abscisic acid (ABA), a plant hormone involved in regulating various physiological processes, including seed dormancy, stress responses, and growth. Phaseic acid is produced by the oxidative cleavage of ABA and plays a role in modulating plant responses to environmental stresses such as drought. It acts by influencing the signaling pathways associated with ABA, helping plants adapt to adverse conditions. Research into phaseic acid explores its potential applications in agriculture to improve crop resilience and productivity under stress conditions.
CAS Number | 24394-14-7 |
Synonyms | (2Z,4E)-5-[(1R,5R,8S)-8-hydroxy-1,5-dimethyl-3-oxo-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid |
Molecular Formula | C15H20O5 |
Purity | ≥95% |
IUPAC Name | (2Z,4E)-5-[(1R,5R,8S)-8-hydroxy-1,5-dimethyl-3-oxo-6-oxabicyclo[3.2.1]octan-8-yl]-3-methylpenta-2,4-dienoic acid |
InChI | InChI=1S/C15H20O5/c1-10(6-12(17)18)4-5-15(19)13(2)7-11(16)8-14(15,3)20-9-13/h4-6,19H,7-9H2,1-3H3,(H,17,18)/b5-4+,10-6-/t13-,14-,15+/m1/s1 |
InChIKey | IZGYIFFQBZWOLJ-UUZREKTLSA-N |
SMILES | C/C(=C/C(=O)O)/C=C/[C@@]1([C@@]2(CC(=O)C[C@]1(OC2)C)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |