For research use only. Not for therapeutic Use.
Phe-Pro-Ala-pNA（Cat No.:I041031）is a synthetic peptide substrate commonly used in enzymatic assays to study protease activity. It consists of phenylalanine (Phe), proline (Pro), alanine (Ala), and p-nitroaniline (pNA) as the chromogenic reporter group. Upon cleavage by proteases, the pNA group is released, producing a yellow color that can be quantitatively measured. This peptide is often employed to evaluate the activity of enzymes such as prolyl oligopeptidases, aminopeptidases, or proteases involved in various biological processes. Its application spans biochemical research, drug screening, and enzyme inhibition studies.
| CAS Number | 201738-99-0 |
| Synonyms | (2S)-1-[(2S)-2-amino-3-phenylpropanoyl]-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
| Molecular Formula | C23H27N5O5 |
| Purity | ≥95% |
| IUPAC Name | (2S)-1-[(2S)-2-amino-3-phenylpropanoyl]-N-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]pyrrolidine-2-carboxamide |
| InChI | InChI=1S/C23H27N5O5/c1-15(21(29)26-17-9-11-18(12-10-17)28(32)33)25-22(30)20-8-5-13-27(20)23(31)19(24)14-16-6-3-2-4-7-16/h2-4,6-7,9-12,15,19-20H,5,8,13-14,24H2,1H3,(H,25,30)(H,26,29)/t15-,19-,20-/m0/s1 |
| InChIKey | IQYNDHOCCCUVDQ-YSSFQJQWSA-N |
| SMILES | C[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)[C@@H]2CCCN2C(=O)[C@H](CC3=CC=CC=C3)N |
