For research use only. Not for therapeutic Use.
Phellamurin is a bioactive flavonoid glycoside extracted from the bark of Phellodendron species. Known for its diverse pharmacological properties, it exhibits antioxidant, anti-inflammatory, and antimicrobial activities. Phellamurin has been studied for its potential in modulating metabolic pathways and protecting against oxidative stress-related conditions. Additionally, it has shown promise in traditional medicine for treating infections and inflammation. As a natural compound, Phellamurin serves as a valuable tool in pharmacological research and the development of therapeutic agents derived from botanical sources.
CAS Number | 52589-11-4 |
Molecular Formula | C26H30O11 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (2R,3R)-3,5-dihydroxy-2-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
InChI | InChI=1S/C26H30O11/c1-11(2)3-8-14-16(35-26-23(34)21(32)19(30)17(10-27)36-26)9-15(29)18-20(31)22(33)24(37-25(14)18)12-4-6-13(28)7-5-12/h3-7,9,17,19,21-24,26-30,32-34H,8,10H2,1-2H3/t17-,19-,21+,22+,23-,24-,26-/m1/s1 |
InChIKey | GRDZTDZJQRPNCN-YIANMRPHSA-N |
SMILES | CC(=CCC1=C(C=C(C2=C1OC(C(C2=O)O)C3=CC=C(C=C3)O)O)OC4C(C(C(C(O4)CO)O)O)O)C |