For research use only. Not for therapeutic Use.
Phen-DC3 (CAT: I010169) is a highly specific G-quadruplex ligand with the unique property of inhibiting G4-DNA unwinding by the Pif1 helicase in vitro. G-quadruplexes are stable secondary structures formed by guanine-rich DNA sequences and play important roles in various biological processes, including gene regulation and telomere maintenance. Phen-DC3 selectively targets and binds to G-quadruplex structures, preventing their unwinding by the Pif1 helicase, an enzyme involved in DNA replication and repair. This specific inhibition of G4-DNA unwinding by Phen-DC3 highlights its potential as a valuable tool for studying G-quadruplex-related processes and exploring therapeutic applications targeting G-quadruplex structures.
| Catalog Number | I010169 |
| CAS Number | 929895-45-4 |
| Synonyms | Phen-DC3 Trifluoromethanesulfonate |
| Molecular Formula | C34H26N6O2 . 2 CF3O3S |
| Purity | 95% |
| Target | G-quadruplex |
| Appearance | Solid |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| IUPAC Name | 2-N,9-N-bis(1-methylquinolin-1-ium-3-yl)-1,10-phenanthroline-2,9-dicarboxamide;trifluoromethanesulfonate |
| InChI | InChI=1S/C34H24N6O2.2CHF3O3S/c1-39-19-25(17-23-7-3-5-9-29(23)39)35-33(41)27-15-13-21-11-12-22-14-16-28(38-32(22)31(21)37-27)34(42)36-26-18-24-8-4-6-10-30(24)40(2)20-26;2*2-1(3,4)8(5,6)7/h3-20H,1-2H3;2*(H,5,6,7) |
| InChIKey | PYJCATLYPXPYHF-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC(=CC2=CC=CC=C21)NC(=O)C3=NC4=C(C=CC5=C4N=C(C=C5)C(=O)NC6=CC7=CC=CC=C7[N+](=C6)C)C=C3.C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-] |
| Reference | 1: Chung WJ, Heddi B, Hamon F, Teulade-Fichou MP, Phan AT. Solution structure of a G-quadruplex bound to the bisquinolinium compound Phen-DC(3). Angew Chem Int Ed Engl. 2014 Jan 20;53(4):999-1002. doi: 10.1002/anie.201308063. Epub 2013 Dec 16. PubMed PMID: 24356977.<br /> |
