For research use only. Not for therapeutic Use.
Phenanthrene-13C6 is a high-purity isotopically labeled compound indispensable for advanced pharmaceutical, environmental, and biochemical research. This version of Phenanthrene, featuring six carbon-13 atoms, is crucial for studies involving polycyclic aromatic hydrocarbons (PAHs), including their metabolism, environmental impact, and toxicology. Its stable isotope labeling ensures precise and consistent analytical results, enhancing the accuracy of quantitative studies. Phenanthrene-13C6 is ideal for use in research focused on environmental monitoring, pollutant tracking, and the assessment of PAH-related health risks. It integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations.
| Catalog Number | R010611 |
| CAS Number | 1189955-53-0 |
| Synonyms | [3]Helicene-13C6; NSC 26256-13C6; Ravatite-13C6; |
| Molecular Formula | C14H10 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | phenanthrene |
| InChI | InChI=1S/C14H10/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10H/i1+1,3+1,5+1,7+1,11+1,13+1 |
| InChIKey | YNPNZTXNASCQKK-KHNBPAKNSA-N |
| SMILES | C1=CC=C2C(=C1)C=C[13C]3=[13CH][13CH]=[13CH][13CH]=[13C]23 |
