For research use only. Not for therapeutic Use.
Phenazine methosulfate（Cat No.:M052182） is a synthetic redox indicator known for its vivid red color and excellent solubility in water. This compound is commonly used in biochemical assays to facilitate electron transfer between enzymes and substrates, acting as an intermediate carrier. Phenazine methosulfate plays a crucial role in the colorimetric detection of certain enzymatic activities, such as those involving dehydrogenases, where it helps in quantifying the presence and concentration of NADH or NADPH.
| Catalog Number | M052182 |
| CAS Number | 10510-77-7 |
| Molecular Formula | C16H18N2O4S |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 5-ethylphenazin-5-ium;ethyl sulfate |
| InChI | InChI=1S/C14H13N2.C2H6O4S/c1-2-16-13-9-5-3-7-11(13)15-12-8-4-6-10-14(12)16;1-2-6-7(3,4)5/h3-10H,2H2,1H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | VDJKJPMLWJWQIH-UHFFFAOYSA-M |
| SMILES | CC[N+]1=C2C=CC=CC2=NC3=CC=CC=C31.CCOS(=O)(=O)[O-] |
